|
CAS#: 721-19-7 Product: Methastyridone No suppilers available for the product. |
| Name | Methastyridone |
|---|---|
| Synonyms | 2,2-Dimethyl-5-(2-Phenylethenyl)-1,3-Oxazolidin-4-One; 2,2-Dimethyl-5-(2-Phenylvinyl)Oxazolidin-4-One; 2,2-Dimethyl-5-[(E)-2-Phenylvinyl]Oxazolidin-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 |
| CAS Registry Number | 721-19-7 |
| SMILES | C1=CC=CC=C1/C=C/C2C(NC(O2)(C)C)=O |
| InChI | 1S/C13H15NO2/c1-13(2)14-12(15)11(16-13)9-8-10-6-4-3-5-7-10/h3-9,11H,1-2H3,(H,14,15)/b9-8+ |
| InChIKey | VEZXEOWXHFHYHC-CMDGGOBGSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.426°C at 760 mmHg (Cal.) |
| Flash point | 195.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methastyridone |