|
CAS#: 72230-90-1 Product: 3-Butyl-1,5-Dimethyl-2-Oxabicyclo[2.2.2]Octane No suppilers available for the product. |
| Name | 3-Butyl-1,5-Dimethyl-2-Oxabicyclo[2.2.2]Octane |
|---|---|
| Synonyms | 2-Oxabicyclo(2.2.2)Octane, 3-Butyl-1,5-Dimethyl-; 3-Butyl-1,5-Dimethyl-2-Oxabicyclo(2.2.2)Octane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 |
| CAS Registry Number | 72230-90-1 |
| SMILES | [C@]12(O[C@@H]([C@@H](CC1)[C@@H](C)C2)CCCC)C |
| InChI | 1S/C13H24O/c1-4-5-6-12-11-7-8-13(3,14-12)9-10(11)2/h10-12H,4-9H2,1-3H3/t10-,11-,12+,13+/m0/s1 |
| InChIKey | SENDFKGNJBUEOA-WUHRBBMRSA-N |
| Density | 0.895g/cm3 (Cal.) |
|---|---|
| Boiling point | 240.32°C at 760 mmHg (Cal.) |
| Flash point | 86.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Butyl-1,5-Dimethyl-2-Oxabicyclo[2.2.2]Octane |