|
CAS#: 7236-84-2 Product: 10-(Anthracen-9-ylmethyl)-10H-anthracen-9-one No suppilers available for the product. |
| Name | 10-(Anthracen-9-ylmethyl)-10H-anthracen-9-one |
|---|---|
| Synonyms | 10-(9-Anthrylmethyl)-10H-Anthracen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C29H20O |
| Molecular Weight | 384.48 |
| CAS Registry Number | 7236-84-2 |
| SMILES | C1=CC2=C(C=C1)C(=C3C(=C2)C=CC=C3)CC5C4=C(C=CC=C4)C(=O)C6=CC=CC=C56 |
| InChI | 1S/C29H20O/c30-29-25-15-7-5-13-23(25)28(24-14-6-8-16-26(24)29)18-27-21-11-3-1-9-19(21)17-20-10-2-4-12-22(20)27/h1-17,28H,18H2 |
| InChIKey | BOCVGMKHBDVRDZ-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.989°C at 760 mmHg (Cal.) |
| Flash point | 258.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-(Anthracen-9-ylmethyl)-10H-anthracen-9-one |