|
CAS#: 72438-01-8 Product: 2-(2,2-Dimethylpropanoylamino)Ethanesulfonic Acid No suppilers available for the product. |
| Name | 2-(2,2-Dimethylpropanoylamino)Ethanesulfonic Acid |
|---|---|
| Synonyms | 2-[(2,2-Dimethyl-1-Oxopropyl)Amino]Ethanesulfonic Acid; 2-(Pivaloylamino)Ethanesulfonic Acid; Ethanesulfonic Acid, 2-((2,2-Dimethyl-1-Oxopropyl)Amino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.26 |
| CAS Registry Number | 72438-01-8 |
| SMILES | C([S](=O)(=O)O)CNC(=O)C(C)(C)C |
| InChI | 1S/C7H15NO4S/c1-7(2,3)6(9)8-4-5-13(10,11)12/h4-5H2,1-3H3,(H,8,9)(H,10,11,12) |
| InChIKey | LEVAVHCQONHMEN-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2,2-Dimethylpropanoylamino)Ethanesulfonic Acid |