|
CAS#: 7252-74-6 Product: 6,7-Dimethyl-4-(Methylamino)-Pteridine No suppilers available for the product. |
| Name | 6,7-Dimethyl-4-(Methylamino)-Pteridine |
|---|---|
| Synonyms | N,6,7-Trimethyl-4-Pteridinamine; (6,7-Dimethylpteridin-4-Yl)-Methyl-Amine; 4-Pteridinamine, N,6,7-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 |
| CAS Registry Number | 7252-74-6 |
| SMILES | C2=NC(=C1N=C(C(=NC1=N2)C)C)NC |
| InChI | 1S/C9H11N5/c1-5-6(2)14-9-7(13-5)8(10-3)11-4-12-9/h4H,1-3H3,(H,10,11,12,14) |
| InChIKey | XZAFACWFMLGMKD-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.418°C at 760 mmHg (Cal.) |
| Flash point | 160.889°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethyl-4-(Methylamino)-Pteridine |