|
CAS#: 7253-63-6 Product: N-(6-Chloro-2-Methyl-Pyrimidin-4-Yl)Acetamide No suppilers available for the product. |
| Name | N-(6-Chloro-2-Methyl-Pyrimidin-4-Yl)Acetamide |
|---|---|
| Synonyms | N-(6-Chloro-2-Methyl-Pyrimidin-4-Yl)Acetamide; N-(6-Chloro-2-Methyl-4-Pyrimidinyl)Acetamide; N-(6-Chloro-2-Methyl-Pyrimidin-4-Yl)Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8ClN3O |
| Molecular Weight | 185.61 |
| CAS Registry Number | 7253-63-6 |
| SMILES | C1=C(NC(C)=O)N=C(C)N=C1Cl |
| InChI | 1S/C7H8ClN3O/c1-4-9-6(8)3-7(10-4)11-5(2)12/h3H,1-2H3,(H,9,10,11,12) |
| InChIKey | FMDCSWYQTLTNPH-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.845°C at 760 mmHg (Cal.) |
| Flash point | 176.267°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(6-Chloro-2-Methyl-Pyrimidin-4-Yl)Acetamide |