|
CAS#: 72586-68-6 Product: 1,3-Dimethyl-3-Phenyl-1-Nitrosourea No suppilers available for the product. |
| Name | 1,3-Dimethyl-3-Phenyl-1-Nitrosourea |
|---|---|
| Synonyms | 1,3-Dimethyl-3-Nitroso-1-Phenyl-Urea; 1,3-Dimethyl-3-Phenyl-1-Nitrosourea; N,N'-Dimethyl-N-Nitroso-N'-Phenylurea |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 72586-68-6 |
| SMILES | C1=CC=CC=C1N(C(N(C)N=O)=O)C |
| InChI | 1S/C9H11N3O2/c1-11(9(13)12(2)10-14)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | KCMWTOXURHICRN-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.936°C at 760 mmHg (Cal.) |
| Flash point | 115.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-3-Phenyl-1-Nitrosourea |