|
CAS#: 72716-70-2 Product: Ethyl 3-(1,3-benzodioxol-5-yl)-2-formylpropanoate No suppilers available for the product. |
| Name | Ethyl 3-(1,3-benzodioxol-5-yl)-2-formylpropanoate |
|---|---|
| Synonyms | ethyl α-formyl-1,3-benzodioxole-5-propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 72716-70-2 |
| EINECS | 276-778-2 |
| SMILES | O=CC(C(=O)OCC)Cc1ccc2OCOc2c1 |
| InChI | 1S/C13H14O5/c1-2-16-13(15)10(7-14)5-9-3-4-11-12(6-9)18-8-17-11/h3-4,6-7,10H,2,5,8H2,1H3 |
| InChIKey | MPWATBGBEKGSJA-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.56°C at 760 mmHg (Cal.) |
| Flash point | 185.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(1,3-benzodioxol-5-yl)-2-formylpropanoate |