|
CAS#: 72727-69-6 Product: 2-[(2,4-Dibromo-5-Methylphenoxy)Methyl]Oxirane No suppilers available for the product. |
| Name | 2-[(2,4-Dibromo-5-Methylphenoxy)Methyl]Oxirane |
|---|---|
| Synonyms | 2-[(2,4-Dibromo-5-Methyl-Phenoxy)Methyl]Oxirane; ((2,4-Dibromo-5-Methylphenoxy)Methyl)Oxirane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 |
| CAS Registry Number | 72727-69-6 |
| EINECS | 276-802-1 |
| SMILES | C1=C(C(=CC(=C1C)Br)Br)OCC2CO2 |
| InChI | 1S/C10H10Br2O2/c1-6-2-10(9(12)3-8(6)11)14-5-7-4-13-7/h2-3,7H,4-5H2,1H3 |
| InChIKey | ZBJLKYJROIWGKA-UHFFFAOYSA-N |
| Density | 1.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.986°C at 760 mmHg (Cal.) |
| Flash point | 148.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,4-Dibromo-5-Methylphenoxy)Methyl]Oxirane |