|
CAS#: 72738-97-7 Product: N-[4-(1-Chloro-9-Acridinylamino)Phenyl]Methanesulfonamide No suppilers available for the product. |
| Name | N-[4-(1-Chloro-9-Acridinylamino)Phenyl]Methanesulfonamide |
|---|---|
| Synonyms | N-[4-[(1-Chloro-9-Acridinyl)Amino]Phenyl]Methanesulfonamide; 4'-(1-Chloro-9-Acridinylamino)Methanesulfonanilide; Brn 5634604 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.88 |
| CAS Registry Number | 72738-97-7 |
| SMILES | C1=CC(=CC=C1N[S](C)(=O)=O)NC3=C2C(=CC=CC2=NC4=CC=CC=C34)Cl |
| InChI | 1S/C20H16ClN3O2S/c1-27(25,26)24-14-11-9-13(10-12-14)22-20-15-5-2-3-7-17(15)23-18-8-4-6-16(21)19(18)20/h2-12,24H,1H3,(H,22,23) |
| InChIKey | ROEMQRRPIKSNLU-UHFFFAOYSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.239°C at 760 mmHg (Cal.) |
| Flash point | 304.113°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(1-Chloro-9-Acridinylamino)Phenyl]Methanesulfonamide |