|
CAS#: 72782-06-0 Product: Oxymorphone Fumarate Methyl Ester No suppilers available for the product. |
| Name | Oxymorphone Fumarate Methyl Ester |
|---|---|
| Synonyms | Oxymorphone Fumarate Methyl Ester; Beta-Foa |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 |
| CAS Registry Number | 72782-06-0 |
| SMILES | [C@]134[C@H]5OC2=C(O)C=CC(=C12)CC(N(CC3)C)[C@]4(O)CC[C@H]5NC(=O)\C=C\C(OC)=O |
| InChI | 1S/C22H26N2O6/c1-24-10-9-21-18-12-3-4-14(25)19(18)30-20(21)13(7-8-22(21,28)15(24)11-12)23-16(26)5-6-17(27)29-2/h3-6,13,15,20,25,28H,7-11H2,1-2H3,(H,23,26)/b6-5+/t13-,15?,20+,21+,22-/m1/s1 |
| InChIKey | VYGVQURMYFVOPO-RDVQCPIUSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 662.211°C at 760 mmHg (Cal.) |
| Flash point | 354.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxymorphone Fumarate Methyl Ester |