|
CAS#: 72785-19-4 Product: 7,8-Epoxydihydrocodeinone No suppilers available for the product. |
| Name | 7,8-Epoxydihydrocodeinone |
|---|---|
| Synonyms | 7,8-Epoxydihydrocodeinone; 7Beta,8Beta-Epoxydihydrocodeinone; Codeinone 7,8-Epoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 |
| CAS Registry Number | 72785-19-4 |
| SMILES | [C@@H]14C6C(C([C@H]2[C@]15C3=C(O2)C(=CC=C3C[C@H]4N(C)CC5)OC)=O)O6 |
| InChI | 1S/C18H19NO4/c1-19-6-5-18-11-8-3-4-10(21-2)14(11)23-17(18)13(20)16-15(22-16)12(18)9(19)7-8/h3-4,9,12,15-17H,5-7H2,1-2H3/t9-,12-,15?,16?,17+,18-/m1/s1 |
| InChIKey | CZFLZQNGKYPMPO-YVBNGIEESA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.995°C at 760 mmHg (Cal.) |
| Flash point | 253.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8-Epoxydihydrocodeinone |