|
CAS#: 72797-29-6 Product: [(E)-2-Methyl-3-Phenylprop-2-Enyl] Acetate No suppilers available for the product. |
| Name | [(E)-2-Methyl-3-Phenylprop-2-Enyl] Acetate |
|---|---|
| Synonyms | [(E)-2-Methyl-3-Phenyl-Prop-2-Enyl] Acetate; Acetic Acid [(E)-2-Methyl-3-Phenylprop-2-Enyl] Ester; Acetic Acid [(E)-2-Methyl-3-Phenyl-Prop-2-Enyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 72797-29-6 |
| SMILES | C1=C(\C=C(\COC(C)=O)C)C=CC=C1 |
| InChI | 1S/C12H14O2/c1-10(9-14-11(2)13)8-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3/b10-8+ |
| InChIKey | BWYPZPVVNMYMKA-CSKARUKUSA-N |
| Density | 1.038g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.868°C at 760 mmHg (Cal.) |
| Flash point | 126.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-2-Methyl-3-Phenylprop-2-Enyl] Acetate |