| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2-[(E)-2-[4-[4-[(E)-2-(2,5-Dimethylphenyl)Ethenyl]Phenyl]Phenyl]Ethenyl]-1,4-Dimethylbenzene |
|---|---|
| Synonyms | 2-[(E)-2-[4-[4-[(E)-2-(2,5-Dimethylphenyl)Vinyl]Phenyl]Phenyl]Vinyl]-1,4-Dimethyl-Benzene; 2-[(E)-2-[4-[4-[(E)-2-(2,5-Dimethylphenyl)Vinyl]Phenyl]Phenyl]Vinyl]-1,4-Dimethylbenzene; 2-[(E)-2-[4-[4-[(E)-2-(2,5-Dimethylphenyl)Ethenyl]Phenyl]Phenyl]Ethenyl]-1,4-Dimethyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C32H30 |
| Molecular Weight | 414.59 |
| CAS Registry Number | 72814-85-8 |
| EINECS | 276-866-0 |
| SMILES | C3=C(C2=CC=C(\C=C\C1=C(C=CC(=C1)C)C)C=C2)C=CC(=C3)\C=C\C4=C(C=CC(=C4)C)C |
| InChI | 1S/C32H30/c1-23-5-7-25(3)31(21-23)19-13-27-9-15-29(16-10-27)30-17-11-28(12-18-30)14-20-32-22-24(2)6-8-26(32)4/h5-22H,1-4H3/b19-13+,20-14+ |
| InChIKey | AMDSCXLLKXHWOJ-IWGRKNQJSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 196-200°C (Expl.) |
| Boiling point | 572.4±50.0°C at 760 mmHg (Cal.) |
| Flash point | 302.1±24.2°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-[(E)-2-[4-[4-[(E)-2-(2,5-Dimethylphenyl)Ethenyl]Phenyl]Phenyl]Ethenyl]-1,4-Dimethylbenzene |