|
CAS#: 72845-36-4 Product: [(E)-3-Methylpent-3-Enyl] Benzoate No suppilers available for the product. |
| Name | [(E)-3-Methylpent-3-Enyl] Benzoate |
|---|---|
| Synonyms | Benzoic Acid [(E)-3-Methylpent-3-Enyl] Ester; 3-Methyl-3-Penten-1-Yl Benzoate; 3-Methylpent-3-En-1-Yl Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 72845-36-4 |
| EINECS | 276-928-7 |
| SMILES | C1=CC=C(C=C1)C(=O)OCC\C(=C\C)C |
| InChI | 1S/C13H16O2/c1-3-11(2)9-10-15-13(14)12-7-5-4-6-8-12/h3-8H,9-10H2,1-2H3/b11-3+ |
| InChIKey | HXFDZDVKIPFWFE-QDEBKDIKSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.816°C at 760 mmHg (Cal.) |
| Flash point | 129.934°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-3-Methylpent-3-Enyl] Benzoate |