|
CAS#: 72928-14-4 Product: 5-Methyl-1-(3-Methyl-1-Cyclohex-3-Enyl)Hexane-1,3-Dione No suppilers available for the product. |
| Name | 5-Methyl-1-(3-Methyl-1-Cyclohex-3-Enyl)Hexane-1,3-Dione |
|---|---|
| Synonyms | 1,3-Hexanedione, 5-Methyl-1-(3-Methyl-3-Cyclohexen-1-Yl)-; 5-Methyl-1-(3-Methyl-3-Cyclohexenyl)-1,3-Hexanedione |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 |
| CAS Registry Number | 72928-14-4 |
| EINECS | 277-053-3 |
| SMILES | C(C(C)C)C(=O)CC(=O)C1CC(=CCC1)C |
| InChI | 1S/C14H22O2/c1-10(2)7-13(15)9-14(16)12-6-4-5-11(3)8-12/h5,10,12H,4,6-9H2,1-3H3 |
| InChIKey | QASVIWADBJDQAA-UHFFFAOYSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.156°C at 760 mmHg (Cal.) |
| Flash point | 119.128°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-1-(3-Methyl-1-Cyclohex-3-Enyl)Hexane-1,3-Dione |