|
CAS#: 72939-46-9 Product: 1-[(2E)-1-Indol-1-Yl-2-(Phenylmethylidene)Octyl]Indole No suppilers available for the product. |
| Name | 1-[(2E)-1-Indol-1-Yl-2-(Phenylmethylidene)Octyl]Indole |
|---|---|
| Synonyms | 1-[(2E)-1-Indol-1-Yl-2-(Phenylmethylene)Octyl]Indole; 1-[(2E)-1-(1-Indolyl)-2-(Phenylmethylene)Octyl]Indole; 1-[(E)-2-Hexyl-1-Indol-1-Yl-3-Phenyl-Prop-2-Enyl]Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C31H32N2 |
| Molecular Weight | 432.61 |
| CAS Registry Number | 72939-46-9 |
| SMILES | C1=CC2=C(C=C1)C=C[N]2C([N]4C3=C(C=CC=C3)C=C4)C(=C/C5=CC=CC=C5)/CCCCCC |
| InChI | 1S/C31H32N2/c1-2-3-4-8-17-28(24-25-13-6-5-7-14-25)31(32-22-20-26-15-9-11-18-29(26)32)33-23-21-27-16-10-12-19-30(27)33/h5-7,9-16,18-24,31H,2-4,8,17H2,1H3/b28-24+ |
| InChIKey | MFGIUZNVZIXAJZ-ZZIIXHQDSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.018°C at 760 mmHg (Cal.) |
| Flash point | 331.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2E)-1-Indol-1-Yl-2-(Phenylmethylidene)Octyl]Indole |