|
CAS#: 72987-43-0 Product: 2-(2,4,6-Triisobutylphenoxy)ethanol No suppilers available for the product. |
| Name | 2-(2,4,6-Triisobutylphenoxy)ethanol |
|---|---|
| Synonyms | 2,4,6-Triisobutylphenol, ethoxylated |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.48 |
| CAS Registry Number | 72987-43-0 |
| SMILES | O(c1c(cc(cc1CC(C)C)CC(C)C)CC(C)C)CCO |
| InChI | 1S/C20H34O2/c1-14(2)9-17-12-18(10-15(3)4)20(22-8-7-21)19(13-17)11-16(5)6/h12-16,21H,7-11H2,1-6H3 |
| InChIKey | RAPHPTULHMOFBS-UHFFFAOYSA-N |
| Density | 0.94g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.698°C at 760 mmHg (Cal.) |
| Flash point | 151.36°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4,6-Triisobutylphenoxy)ethanol |