|
CAS#: 731-92-0 Product: 2,4-Dinitro-6-Phenylphenol No suppilers available for the product. |
| Name | 2,4-Dinitro-6-Phenylphenol |
|---|---|
| Synonyms | 2,4-Dinitro-6-Phenyl-Phenol; 2-Biphenylol, 3,5-Dinitro-; 3,5-Dinitro-2-Biphenylol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O5 |
| Molecular Weight | 260.21 |
| CAS Registry Number | 731-92-0 |
| SMILES | C1=CC=C(C=C1)C2=C(O)C(=CC(=C2)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C12H8N2O5/c15-12-10(8-4-2-1-3-5-8)6-9(13(16)17)7-11(12)14(18)19/h1-7,15H |
| InChIKey | HXNGWMWUICJCDR-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.428°C at 760 mmHg (Cal.) |
| Flash point | 168.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitro-6-Phenylphenol |