|
CAS#: 73195-13-8 Product: (2,6-Dimethylphenyl) Bis(2,4,6-Trimethylphenyl) Phosphate No suppilers available for the product. |
| Name | (2,6-Dimethylphenyl) Bis(2,4,6-Trimethylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid (2,6-Dimethylphenyl) Bis(2,4,6-Trimethylphenyl) Ester; Di(2,4,6-Trimethylphenyl) 2,6-Dimethylphenyl Phosphate; Phosphoric Acid, 2,6-Dimethylphenyl Bis(2,4,6-Trimethylphenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C26H31O4P |
| Molecular Weight | 438.50 |
| CAS Registry Number | 73195-13-8 |
| SMILES | C1=C(C)C(=C(C=C1)C)O[P](=O)(OC2=C(C=C(C=C2C)C)C)OC3=C(C=C(C=C3C)C)C |
| InChI | 1S/C26H31O4P/c1-16-12-20(5)25(21(6)13-16)29-31(27,28-24-18(3)10-9-11-19(24)4)30-26-22(7)14-17(2)15-23(26)8/h9-15H,1-8H3 |
| InChIKey | RXFNJSYEKXOEDI-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.675°C at 760 mmHg (Cal.) |
| Flash point | 248.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dimethylphenyl) Bis(2,4,6-Trimethylphenyl) Phosphate |