|
CAS#: 73179-43-8 Product: Diphenyl (2,4,6-Trimethylphenyl) Phosphate No suppilers available for the product. |
| Name | Diphenyl (2,4,6-Trimethylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Diphenyl (2,4,6-Trimethylphenyl) Ester; Diphenyl 2,4,6-Trimethylphenyl Phosphate; Phosphoric Acid, Diphenyl 2,4,6-Trimethylphenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.37 |
| CAS Registry Number | 73179-43-8 |
| SMILES | C1=C(C=CC=C1)O[P](=O)(OC2=CC=CC=C2)OC3=C(C=C(C=C3C)C)C |
| InChI | 1S/C21H21O4P/c1-16-14-17(2)21(18(3)15-16)25-26(22,23-19-10-6-4-7-11-19)24-20-12-8-5-9-13-20/h4-15H,1-3H3 |
| InChIKey | TZNDMQPVWYWNFW-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.342°C at 760 mmHg (Cal.) |
| Flash point | 220.235°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenyl (2,4,6-Trimethylphenyl) Phosphate |