|
CAS#: 7320-45-8 Product: Sodium 1,4-Diethyl Sulphonatosuccinate No suppilers available for the product. |
| Name | Sodium 1,4-Diethyl Sulphonatosuccinate |
|---|---|
| Synonyms | 1,4-Diethoxy-1,4-Dioxo-Butane-2-Sulfonic Acid; Sodium; 1,4-Diethoxy-1,4-Diketo-Butane-2-Sulfonic Acid; Sodium; Nsc158579 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14NaO7S |
| Molecular Weight | 277.24 |
| CAS Registry Number | 7320-45-8 |
| EINECS | 230-787-8 |
| SMILES | [Na].C(OC(CC(C(OCC)=O)[S](=O)(=O)O)=O)C |
| InChI | 1S/C8H14O7S.Na/c1-3-14-7(9)5-6(16(11,12)13)8(10)15-4-2;/h6H,3-5H2,1-2H3,(H,11,12,13); |
| InChIKey | BCVZNCWCAQBFPQ-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Sodium 1,4-Diethyl Sulphonatosuccinate |