|
CAS#: 73207-98-4 Product: 2-(Di(Propan-2-Yl)Amino)Ethylsulfanyl-Methylphosphinic Acid No suppilers available for the product. |
| Name | 2-(Di(Propan-2-Yl)Amino)Ethylsulfanyl-Methylphosphinic Acid |
|---|---|
| Synonyms | 2-(Diisopropylamino)Ethylsulfanyl-Methyl-Phosphinic Acid; [2-(Diisopropylamino)Ethylthio]-Methylphosphinic Acid; [2-(Diisopropylamino)Ethylthio]-Methyl-Phosphinic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H22NO2PS |
| Molecular Weight | 239.31 |
| CAS Registry Number | 73207-98-4 |
| SMILES | C(S[P](=O)(O)C)CN(C(C)C)C(C)C |
| InChI | 1S/C9H22NO2PS/c1-8(2)10(9(3)4)6-7-14-13(5,11)12/h8-9H,6-7H2,1-5H3,(H,11,12) |
| InChIKey | UOXJNGFFPMOZDM-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.545°C at 760 mmHg (Cal.) |
| Flash point | 153.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Di(Propan-2-Yl)Amino)Ethylsulfanyl-Methylphosphinic Acid |