|
CAS#: 73341-71-6 Product: Methyl (E,2E,3S,4S)-4-Methoxy-2-(Methoxymethylidene)-3-Methyl-6-Phenylhex-5-Enoate No suppilers available for the product. |
| Name | Methyl (E,2E,3S,4S)-4-Methoxy-2-(Methoxymethylidene)-3-Methyl-6-Phenylhex-5-Enoate |
|---|---|
| Synonyms | Methyl (E,2E,3S,4S)-4-Methoxy-2-(Methoxymethylene)-3-Methyl-6-Phenyl-Hex-5-Enoate; (E,2E,3S,4S)-4-Methoxy-2-(Methoxymethylene)-3-Methyl-6-Phenylhex-5-Enoic Acid Methyl Ester; (E,2E,3S,4S)-4-Methoxy-2-(Methoxymethylene)-3-Methyl-6-Phenyl-Hex-5-Enoic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 |
| CAS Registry Number | 73341-71-6 |
| SMILES | [C@H](\C(C(=O)OC)=C/OC)([C@H](\C=C\C1=CC=CC=C1)OC)C |
| InChI | 1S/C17H22O4/c1-13(15(12-19-2)17(18)21-4)16(20-3)11-10-14-8-6-5-7-9-14/h5-13,16H,1-4H3/b11-10+,15-12+/t13-,16-/m0/s1 |
| InChIKey | COBDENJOXQSLKO-NKAAJRRHSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.548°C at 760 mmHg (Cal.) |
| Flash point | 179.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (E,2E,3S,4S)-4-Methoxy-2-(Methoxymethylidene)-3-Methyl-6-Phenylhex-5-Enoate |