|
CAS#: 73384-98-2 Product: 4,5,6,7-Tetrachloro-1,2-Dihydro-3H-Indol-3-One No suppilers available for the product. |
| Name | 4,5,6,7-Tetrachloro-1,2-Dihydro-3H-Indol-3-One |
|---|---|
| Synonyms | 4,5,6,7-Tetrachloroindolin-3-One; 4,5,6,7-Tetrachloro-3-Indolinone; 4,5,6,7-Tetrachloropseudoindoxyl |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3Cl4NO |
| Molecular Weight | 270.93 |
| CAS Registry Number | 73384-98-2 |
| SMILES | C1(=C2C(=C(C(=C1Cl)Cl)Cl)C(=O)CN2)Cl |
| InChI | 1S/C8H3Cl4NO/c9-4-3-2(14)1-13-8(3)7(12)6(11)5(4)10/h13H,1H2 |
| InChIKey | UVKYAVIASVBOME-UHFFFAOYSA-N |
| Density | 1.705g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.998°C at 760 mmHg (Cal.) |
| Flash point | 216.88°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6,7-Tetrachloro-1,2-Dihydro-3H-Indol-3-One |