|
CAS#: 73395-21-8 Product: 1-Ethyltricyclo[2.2.1.02,6]Heptan-3-Ol Propanoate No suppilers available for the product. |
| Name | 1-Ethyltricyclo[2.2.1.02,6]Heptan-3-Ol Propanoate |
|---|---|
| Synonyms | Tricyclo(2.2.1.02,6)Heptan-3-Ol, 1-Ethyl-, Propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 73395-21-8 |
| SMILES | C(C13C2C1CC(C2OC(=O)CC)C3)C |
| InChI | 1S/C12H18O2/c1-3-9(13)14-11-7-5-8-10(11)12(8,4-2)6-7/h7-8,10-11H,3-6H2,1-2H3 |
| InChIKey | FPRVVHKYFTWIGU-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.384°C at 760 mmHg (Cal.) |
| Flash point | 95.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyltricyclo[2.2.1.02,6]Heptan-3-Ol Propanoate |