|
CAS#: 73427-32-4 Product: (2R,3R)-1,4-Dithionitrosooxybutane-2,3-Diol No suppilers available for the product. |
| Name | (2R,3R)-1,4-Dithionitrosooxybutane-2,3-Diol |
|---|---|
| Synonyms | S-Nitroso-Dtt; S-Nitrosodithiothreitol; Thionitrous Acid, S,S'-(2,3-Dihydroxy-1,4-Butanediyl) Ester, (R*,R*)- |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8N2O4S2 |
| Molecular Weight | 212.24 |
| CAS Registry Number | 73427-32-4 |
| SMILES | [C@@H](CON=S)([C@@H](CON=S)O)O |
| InChI | 1S/C4H8N2O4S2/c7-3(1-9-5-11)4(8)2-10-6-12/h3-4,7-8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | KIODQSOCCGHCJX-QWWZWVQMSA-N |
| Density | 1.617g/cm3 (Cal.) |
|---|---|
| Boiling point | 344°C at 760 mmHg (Cal.) |
| Flash point | 161.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3R)-1,4-Dithionitrosooxybutane-2,3-Diol |