|
CAS#: 73553-68-1 Product: ((Methyl-3 benzyl)-4 thiazolyl-2)-1 piperazine hemisulfate hemihydrate No suppilers available for the product. |
| Name | ((Methyl-3 benzyl)-4 thiazolyl-2)-1 piperazine hemisulfate hemihydrate |
|---|---|
| Synonyms | 1-[4-[(3-Methylphenyl)Methyl]Thiazol-2-Yl]Piperazine; 1-[4-(M-Tolylmethyl)Thiazol-2-Yl]Piperazine; Sulfuric Acid; 1-[4-[(3-Methylphenyl)Methyl]-2-Thiazolyl]Piperazine; 1-[4-(M-Tolylmethyl)-2-Thiazolyl]Piperazine; Sulfuric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C30H40N6O4S3 |
| Molecular Weight | 644.86 |
| CAS Registry Number | 73553-68-1 |
| SMILES | C1=C(N=C(S1)N2CCNCC2)CC3=CC=CC(=C3)C.C4=C(N=C(S4)N5CCNCC5)CC6=CC=CC(=C6)C.O=[S](=O)(O)O |
| InChI | 1S/2C15H19N3S.H2O4S/c2*1-12-3-2-4-13(9-12)10-14-11-19-15(17-14)18-7-5-16-6-8-18;1-5(2,3)4/h2*2-4,9,11,16H,5-8,10H2,1H3;(H2,1,2,3,4) |
| InChIKey | KMHWIXYCFLTBDA-UHFFFAOYSA-N |
| Boiling point | 429.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 213.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ((Methyl-3 benzyl)-4 thiazolyl-2)-1 piperazine hemisulfate hemihydrate |