|
CAS#: 7357-41-7 Product: 3-{[3-(Chlorosulfonyl)Phenyl]Sulfonyl}Benzenesulfonyl Chloride No suppilers available for the product. |
| Name | 3-{[3-(Chlorosulfonyl)Phenyl]Sulfonyl}Benzenesulfonyl Chloride |
|---|---|
| Synonyms | Nsc59822 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2O6S3 |
| Molecular Weight | 415.28 |
| CAS Registry Number | 7357-41-7 |
| SMILES | C2=C([S](C1=CC(=CC=C1)[S](=O)(=O)Cl)(=O)=O)C=CC=C2[S](=O)(=O)Cl |
| InChI | 1S/C12H8Cl2O6S3/c13-22(17,18)11-5-1-3-9(7-11)21(15,16)10-4-2-6-12(8-10)23(14,19)20/h1-8H |
| InChIKey | JCIFZSCARAOKME-UHFFFAOYSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.759°C at 760 mmHg (Cal.) |
| Flash point | 327.409°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-{[3-(Chlorosulfonyl)Phenyl]Sulfonyl}Benzenesulfonyl Chloride |