|
CAS#: 7359-04-8 Product: 1-(2,3,5,6,7,8-Hexahydro-1,1-Dimethyl-1H-Benz[f]Inden-4-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(2,3,5,6,7,8-Hexahydro-1,1-Dimethyl-1H-Benz[f]Inden-4-Yl)Ethanone |
|---|---|
| Synonyms | 1-(2,3,5,6,7,8-Hexahydro-1,1-Dimethyl-1H-Benz(F)Inden-4-Yl)Ethan-1-One; 4-Acetyl-2,3,5,6,7,8-Hexahydro-1,1-Dimethyl-1H-Benz(F)Indene |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 |
| CAS Registry Number | 7359-04-8 |
| EINECS | 230-893-4 |
| SMILES | C2=C1C(CCC1=C(C3=C2CCCC3)C(=O)C)(C)C |
| InChI | 1S/C17H22O/c1-11(18)16-13-7-5-4-6-12(13)10-15-14(16)8-9-17(15,2)3/h10H,4-9H2,1-3H3 |
| InChIKey | HIQNCQIKWYJQJH-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.202°C at 760 mmHg (Cal.) |
| Flash point | 162.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,3,5,6,7,8-Hexahydro-1,1-Dimethyl-1H-Benz[f]Inden-4-Yl)Ethanone |