|
CAS#: 73604-74-7 Product: 1-Methyl-3-propyl-3-(2-thienyl)pyrrolidine (E)-2-butenedioate No suppilers available for the product. |
| Name | 1-Methyl-3-propyl-3-(2-thienyl)pyrrolidine (E)-2-butenedioate |
|---|---|
| Synonyms | But-2-Enedioic Acid; 1-Methyl-3-Propyl-3-(2-Thienyl)Pyrrolidine; But-2-Enedioic Acid; 1-Methyl-3-Propyl-3-Thiophen-2-Yl-Pyrrolidine; 1-Methyl-3-Propyl-3-(2-Thienyl)Pyrrolidine (E)-2-Butenedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.42 |
| CAS Registry Number | 73604-74-7 |
| SMILES | C1=C(SC=C1)C2(CN(CC2)C)CCC.O=C(O)\C=C\C(=O)O |
| InChI | 1S/C12H19NS.C4H4O4/c1-3-6-12(7-8-13(2)10-12)11-5-4-9-14-11;5-3(6)1-2-4(7)8/h4-5,9H,3,6-8,10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QFUNAUMZOPMYDE-WLHGVMLRSA-N |
| Boiling point | 281.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-propyl-3-(2-thienyl)pyrrolidine (E)-2-butenedioate |