|
CAS#: 73622-70-5 Product: 1-[4-(2,3-Dihydroxypropoxy)Naphthalen-1-Yl]Ethanone No suppilers available for the product. |
| Name | 1-[4-(2,3-Dihydroxypropoxy)Naphthalen-1-Yl]Ethanone |
|---|---|
| Synonyms | 1-[4-(2,3-Dihydroxypropoxy)-1-Naphthyl]Ethanone; 1-(4-Glyceryloxy-1-Naphthyl)Ethanone; Brn 2588399 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 73622-70-5 |
| SMILES | C1=CC=CC2=C(C=CC(=C12)C(C)=O)OCC(CO)O |
| InChI | 1S/C15H16O4/c1-10(17)12-6-7-15(19-9-11(18)8-16)14-5-3-2-4-13(12)14/h2-7,11,16,18H,8-9H2,1H3 |
| InChIKey | BJALSSVHDGXABC-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.704°C at 760 mmHg (Cal.) |
| Flash point | 192.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(2,3-Dihydroxypropoxy)Naphthalen-1-Yl]Ethanone |