|
CAS#: 73623-07-1 Product: 2-Sulfanylethyl N-(2,5-Dichlorophenyl)Carbamate No suppilers available for the product. |
| Name | 2-Sulfanylethyl N-(2,5-Dichlorophenyl)Carbamate |
|---|---|
| Synonyms | N-(2,5-Dichlorophenyl)Carbamic Acid 2-Mercaptoethyl Ester; 2-Mercaptoethyl 2,5-Dichlorocarbanilate; Carbanilic Acid, 2,5-Dichloro-, 2-Mercaptoethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Cl2NO2S |
| Molecular Weight | 266.14 |
| CAS Registry Number | 73623-07-1 |
| SMILES | C1=C(C(=CC=C1Cl)Cl)NC(OCCS)=O |
| InChI | 1S/C9H9Cl2NO2S/c10-6-1-2-7(11)8(5-6)12-9(13)14-3-4-15/h1-2,5,15H,3-4H2,(H,12,13) |
| InChIKey | ZJIFMHJRHKCSEP-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.13°C at 760 mmHg (Cal.) |
| Flash point | 147.41°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Sulfanylethyl N-(2,5-Dichlorophenyl)Carbamate |