|
CAS#: 73637-16-8 Product: 1-(1,2,8-Trihydroxyanthracen-9-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(1,2,8-Trihydroxyanthracen-9-Yl)Ethanone |
|---|---|
| Synonyms | 1-(1,2,8-Trihydroxy-9-Anthryl)Ethanone; 9-Acetyl-1,7,8-Anthracenetriol; 1,7,8-Anthracenetriol, 9-Acetyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 73637-16-8 |
| SMILES | C1=C3C(=C(C2=C(O)C(=CC=C12)O)C(=O)C)C(=CC=C3)O |
| InChI | 1S/C16H12O4/c1-8(17)13-14-9(3-2-4-11(14)18)7-10-5-6-12(19)16(20)15(10)13/h2-7,18-20H,1H3 |
| InChIKey | DPMKTCIVEBLMCB-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.592°C at 760 mmHg (Cal.) |
| Flash point | 318.368°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,2,8-Trihydroxyanthracen-9-Yl)Ethanone |