|
CAS#: 7364-23-0 Product: 4-Chloro-alpha-Phenylbenzyl(Methyl) Ether No suppilers available for the product. |
| Name | 4-Chloro-alpha-Phenylbenzyl(Methyl) Ether |
|---|---|
| Synonyms | 1-Chloro-4-(Methoxy-Phenyl-Methyl)Benzene; Nsc63477; 1-Chloro-4-[Methoxy(Phenyl)Methyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13ClO |
| Molecular Weight | 232.71 |
| CAS Registry Number | 7364-23-0 |
| SMILES | C1=CC=CC=C1C(OC)C2=CC=C(C=C2)Cl |
| InChI | 1S/C14H13ClO/c1-16-14(11-5-3-2-4-6-11)12-7-9-13(15)10-8-12/h2-10,14H,1H3 |
| InChIKey | YYZKQWJAQAXRAH-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.558°C at 760 mmHg (Cal.) |
| Flash point | 140.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-alpha-Phenylbenzyl(Methyl) Ether |