|
CAS#: 73652-75-2 Product: 2-Tert-Butyl-1-Methylnaphthalene No suppilers available for the product. |
| Name | 2-Tert-Butyl-1-Methylnaphthalene |
|---|---|
| Synonyms | 2-Tert-Butyl-1-Methyl-Naphthalene; Naphthalene, 2-(1,1-Dimethylethyl)-1-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 |
| CAS Registry Number | 73652-75-2 |
| EINECS | 277-559-4 |
| SMILES | C1=CC2=C(C(=C1C(C)(C)C)C)C=CC=C2 |
| InChI | 1S/C15H18/c1-11-13-8-6-5-7-12(13)9-10-14(11)15(2,3)4/h5-10H,1-4H3 |
| InChIKey | XMVIROUTBQYNDR-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.655°C at 760 mmHg (Cal.) |
| Flash point | 134.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Tert-Butyl-1-Methylnaphthalene |