|
CAS#: 73663-88-4 Product: 4-Methoxy-10H-Acridin-9-One No suppilers available for the product. |
| Name | 4-Methoxy-10H-Acridin-9-One |
|---|---|
| Synonyms | 4-Methoxyacridin-9(10H)-One; Nciopen2_004105 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 |
| CAS Registry Number | 73663-88-4 |
| EINECS | 252-505-2 |
| SMILES | C2=CC=C1C(C3=C(NC1=C2)C(=CC=C3)OC)=O |
| InChI | 1S/C14H11NO2/c1-17-12-8-4-6-10-13(12)15-11-7-3-2-5-9(11)14(10)16/h2-8H,1H3,(H,15,16) |
| InChIKey | ZYEVJRPVZZGDRM-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 286°C (Expl.) |
| Boiling point | 449.0±15.0°C at 760 mmHg (Cal.) |
| Flash point | 225.3±20.4°C (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | IRRITANT |
| WARNING: Irritates lungs, eyes, skin | |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-10H-Acridin-9-One |