Online Database of Chemicals from Around the World
|
CAS#: 73664-35-4 Product: 2,2-Bis[(4-Methylphenyl)Sulfanyl]Acetamide No suppilers available for the product. |
| Name | 2,2-Bis[(4-Methylphenyl)Sulfanyl]Acetamide |
|---|---|
| Synonyms | 2,2-Bis[(4-Methylphenyl)Thio]Acetamide; 2,2-Bis[(4-Methylphenyl)Sulfanyl]Ethanamide; 3-06-00-01426 (Beilstein Handbook Reference) |
| Molecular Structure | ![CAS#: 73664-35-4, 2,2-Bis[(4-Methylphenyl)Sulfanyl]Acetamide](/moreStructures/73664-35-4.gif) |
| Molecular Formula | C16H17NOS2 |
| Molecular Weight | 303.44 |
| CAS Registry Number | 73664-35-4 |
| SMILES | C1=CC(=CC=C1SC(C(=O)N)SC2=CC=C(C=C2)C)C |
| InChI | 1S/C16H17NOS2/c1-11-3-7-13(8-4-11)19-16(15(17)18)20-14-9-5-12(2)6-10-14/h3-10,16H,1-2H3,(H2,17,18) |
| InChIKey | KELLHNUIOFYNJU-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.745°C at 760 mmHg (Cal.) |
| Flash point | 231.241°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis[(4-Methylphenyl)Sulfanyl]Acetamide |