|
CAS#: 73680-53-2 Product: N-(Benzyloxycarbonyl)-3-(Vinyloxycarbonyl)-L-Alanine Vinyl Ester No suppilers available for the product. |
| Name | N-(Benzyloxycarbonyl)-3-(Vinyloxycarbonyl)-L-Alanine Vinyl Ester |
|---|---|
| Synonyms | Divinyl (2S)-2-(Phenylmethoxycarbonylamino)Butanedioate; (2S)-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]Butanedioic Acid Divinyl Ester; (2S)-2-(Benzyloxycarbonylamino)Succinic Acid Divinyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 |
| CAS Registry Number | 73680-53-2 |
| SMILES | [C@H](NC(OCC1=CC=CC=C1)=O)(CC(OC=C)=O)C(OC=C)=O |
| InChI | 1S/C16H17NO6/c1-3-21-14(18)10-13(15(19)22-4-2)17-16(20)23-11-12-8-6-5-7-9-12/h3-9,13H,1-2,10-11H2,(H,17,20)/t13-/m0/s1 |
| InChIKey | UDBXJDZZHOVCPP-ZDUSSCGKSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.063°C at 760 mmHg (Cal.) |
| Flash point | 230.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Benzyloxycarbonyl)-3-(Vinyloxycarbonyl)-L-Alanine Vinyl Ester |