|
CAS#: 73693-25-1 Product: 4-Anthracen-2-Ylbutanoic Acid No suppilers available for the product. |
| Name | 4-Anthracen-2-Ylbutanoic Acid |
|---|---|
| Synonyms | 4-(2-Anthryl)Butanoic Acid; 4-(2-Anthryl)Butyric Acid; 2-Anthracenebutyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 73693-25-1 |
| SMILES | C1=C3C(=CC2=CC=C(C=C12)CCCC(=O)O)C=CC=C3 |
| InChI | 1S/C18H16O2/c19-18(20)7-3-4-13-8-9-16-11-14-5-1-2-6-15(14)12-17(16)10-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20) |
| InChIKey | AEUBCEDJMLUFGL-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.213°C at 760 mmHg (Cal.) |
| Flash point | 383.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Anthracen-2-Ylbutanoic Acid |