|
CAS#: 737-14-4 Product: N-(3-Bromopropyl)-4-Methyl-N-Phenyl-Benzenesulfonamide No suppilers available for the product. |
| Name | N-(3-Bromopropyl)-4-Methyl-N-Phenyl-Benzenesulfonamide |
|---|---|
| Synonyms | N-(3-Bromopropyl)-4-Methyl-N-Phenyl-Benzenesulfonamide; N-[3-Bromopropyl]-P-Toluenesulfonanilide; Nciopen2_009331 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.29 |
| CAS Registry Number | 737-14-4 |
| SMILES | C1=CC=CC=C1N([S](C2=CC=C(C=C2)C)(=O)=O)CCCBr |
| InChI | 1S/C16H18BrNO2S/c1-14-8-10-16(11-9-14)21(19,20)18(13-5-12-17)15-6-3-2-4-7-15/h2-4,6-11H,5,12-13H2,1H3 |
| InChIKey | MPNVXJNVUADUDJ-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.116°C at 760 mmHg (Cal.) |
| Flash point | 238.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Bromopropyl)-4-Methyl-N-Phenyl-Benzenesulfonamide |