|
CAS#: 73728-56-0 Product: 1,3-Dibromo-7-Nitro-9H-Fluoren-2-Ol No suppilers available for the product. |
| Name | 1,3-Dibromo-7-Nitro-9H-Fluoren-2-Ol |
|---|---|
| Synonyms | 1,3-Dibromo-7-Nitro-2-Fluorenol; 2-Fluorenol, 1,3-Dibromo-7-Nitro-; 9H-Fluoren-2-Ol, 1,3-Dibromo-7-Nitro- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7Br2NO3 |
| Molecular Weight | 385.01 |
| CAS Registry Number | 73728-56-0 |
| SMILES | C1=C(Br)C(=C(Br)C2=C1C3=C(C2)C=C([N+]([O-])=O)C=C3)O |
| InChI | 1S/C13H7Br2NO3/c14-11-5-9-8-2-1-7(16(18)19)3-6(8)4-10(9)12(15)13(11)17/h1-3,5,17H,4H2 |
| InChIKey | QPLUCUVSAFPXOA-UHFFFAOYSA-N |
| Density | 2.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.111°C at 760 mmHg (Cal.) |
| Flash point | 231.462°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dibromo-7-Nitro-9H-Fluoren-2-Ol |