|
CAS#: 73713-83-4 Product: 2-Phenyl-2H-1,3,2-benzothiazaphosphorine 2-sulfide No suppilers available for the product. |
| Name | 2-Phenyl-2H-1,3,2-benzothiazaphosphorine 2-sulfide |
|---|---|
| Synonyms | 9-Phenyl-9-Thioxo-10-Thia-8-Aza-9$L^{5}-Phosphabicyclo[4.4.0]Deca-1,3,5,7-Tetraene; 2-Phenyl-2H-1,3,2-Benzothiazaphosphorine 2-Sulfide; 2H-1,3,2-Benzothiazaphosphorine, 2-Phenyl-, 2-Sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10NPS2 |
| Molecular Weight | 275.32 |
| CAS Registry Number | 73713-83-4 |
| SMILES | C2=C1C=N[P](SC1=CC=C2)(C3=CC=CC=C3)=S |
| InChI | 1S/C13H10NPS2/c16-15(12-7-2-1-3-8-12)14-10-11-6-4-5-9-13(11)17-15/h1-10H |
| InChIKey | JDXYRORFFQDVQD-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.973°C at 760 mmHg (Cal.) |
| Flash point | 224.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-2H-1,3,2-benzothiazaphosphorine 2-sulfide |