|
CAS#: 73728-79-7 Product: 4-(2,5-Dimethylphenyl)-2-Methylaniline No suppilers available for the product. |
| Name | 4-(2,5-Dimethylphenyl)-2-Methylaniline |
|---|---|
| Synonyms | 4-(2,5-Dimethylphenyl)-2-Methyl-Aniline; [4-(2,5-Dimethylphenyl)-2-Methyl-Phenyl]Amine; 3,2',5'-Trimethyl-4-Aminodiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 |
| CAS Registry Number | 73728-79-7 |
| SMILES | C1=C(C(=CC=C1C2=C(C=CC(=C2)C)C)N)C |
| InChI | 1S/C15H17N/c1-10-4-5-11(2)14(8-10)13-6-7-15(16)12(3)9-13/h4-9H,16H2,1-3H3 |
| InChIKey | SKSNKNFLXPZBMD-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.962°C at 760 mmHg (Cal.) |
| Flash point | 149.868°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,5-Dimethylphenyl)-2-Methylaniline |