|
CAS#: 7373-26-4 Product: Toluene-2,4,6-Triyl Triisocyanate No suppilers available for the product. |
| Name | Toluene-2,4,6-Triyl Triisocyanate |
|---|---|
| Synonyms | 1,3,5-Triisocyanato-2-Methyl-Benzene; Toluene-2,4,6-Triyl Triisocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5N3O3 |
| Molecular Weight | 215.17 |
| CAS Registry Number | 7373-26-4 |
| EINECS | 230-932-5 |
| SMILES | O=C=NC1=CC(=C(C(=C1)N=C=O)C)N=C=O |
| InChI | 1S/C10H5N3O3/c1-7-9(12-5-15)2-8(11-4-14)3-10(7)13-6-16/h2-3H,1H3 |
| InChIKey | PFUKECZPRROVOD-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.987°C at 760 mmHg (Cal.) |
| Flash point | 134.436°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Toluene-2,4,6-Triyl Triisocyanate |