|
CAS#: 73747-30-5 Product: 2-Bromo-2-Methyl-1-[4-(4-Nitrophenyl)Phenyl]Butan-1-One No suppilers available for the product. |
| Name | 2-Bromo-2-Methyl-1-[4-(4-Nitrophenyl)Phenyl]Butan-1-One |
|---|---|
| Synonyms | 2-Bromo-2-Methyl-4'-(P-Nitrophenyl)Butyrophenone; Butyrophenone, 2-Bromo-2-Methyl-4'-(P-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 |
| CAS Registry Number | 73747-30-5 |
| SMILES | C1=C(C(=O)C(Br)(CC)C)C=CC(=C1)C2=CC=C([N+]([O-])=O)C=C2 |
| InChI | 1S/C17H16BrNO3/c1-3-17(2,18)16(20)14-6-4-12(5-7-14)13-8-10-15(11-9-13)19(21)22/h4-11H,3H2,1-2H3 |
| InChIKey | BTBDSYJRQMVIMH-UHFFFAOYSA-N |
| Density | 1.389g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.718°C at 760 mmHg (Cal.) |
| Flash point | 231.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-2-Methyl-1-[4-(4-Nitrophenyl)Phenyl]Butan-1-One |