|
CAS#: 73747-39-4 Product: 1,3,7-Trimethyl-8-[(E)-Prop-1-Enyl]Purine-2,6-Dione No suppilers available for the product. |
| Name | 1,3,7-Trimethyl-8-[(E)-Prop-1-Enyl]Purine-2,6-Dione |
|---|---|
| Synonyms | 1,3,7-Trimethyl-8-Prop-1-Enylpurine-2,6-Dione; 1,3,7-Trimethyl-8-Prop-1-Enyl-Purine-2,6-Dione; 1,3,7-Trimethyl-8-Prop-1-Enyl-Xanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 |
| CAS Registry Number | 73747-39-4 |
| SMILES | CN2C1=C([N](C(=N1)\C=C\C)C)C(N(C2=O)C)=O |
| InChI | 1S/C11H14N4O2/c1-5-6-7-12-9-8(13(7)2)10(16)15(4)11(17)14(9)3/h5-6H,1-4H3/b6-5+ |
| InChIKey | NLJFVWINVFJJCG-AATRIKPKSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.194°C at 760 mmHg (Cal.) |
| Flash point | 216.393°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,7-Trimethyl-8-[(E)-Prop-1-Enyl]Purine-2,6-Dione |