|
CAS#: 73747-53-2 Product: 1-Indol-1-Ylpropan-1-One No suppilers available for the product. |
| Name | 1-Indol-1-Ylpropan-1-One |
|---|---|
| Synonyms | 1-(1-Indolyl)Propan-1-One; St5443329; 1H-Indole, 1-(1-Oxopropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 |
| CAS Registry Number | 73747-53-2 |
| EINECS | 277-583-5 |
| SMILES | C1=CC=CC2=C1[N](C=C2)C(CC)=O |
| InChI | 1S/C11H11NO/c1-2-11(13)12-8-7-9-5-3-4-6-10(9)12/h3-8H,2H2,1H3 |
| InChIKey | XBYKGSPCVQTMGF-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.202°C at 760 mmHg (Cal.) |
| Flash point | 120.843°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Indol-1-Ylpropan-1-One |