|
CAS#: 73747-60-1 Product: Diethyl 2-Acetamido-2-[(7-Amino-1H-Indol-3-Yl)Methyl]Propanedioate No suppilers available for the product. |
| Name | Diethyl 2-Acetamido-2-[(7-Amino-1H-Indol-3-Yl)Methyl]Propanedioate |
|---|---|
| Synonyms | 2-Acetamido-2-[(7-Amino-1H-Indol-3-Yl)Methyl]Propanedioic Acid Diethyl Ester; 2-Acetamido-2-[(7-Amino-1H-Indol-3-Yl)Methyl]Malonic Acid Diethyl Ester; 2-Acetamido-2-(7-Amino-3-Indolylmethyl)Malonic Acid Diethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 |
| CAS Registry Number | 73747-60-1 |
| SMILES | C2=C(CC(C(OCC)=O)(C(OCC)=O)NC(C)=O)C1=C(C(=CC=C1)N)[NH]2 |
| InChI | 1S/C18H23N3O5/c1-4-25-16(23)18(21-11(3)22,17(24)26-5-2)9-12-10-20-15-13(12)7-6-8-14(15)19/h6-8,10,20H,4-5,9,19H2,1-3H3,(H,21,22) |
| InChIKey | WGCAXLXBSOFFAE-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.279°C at 760 mmHg (Cal.) |
| Flash point | 321.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 2-Acetamido-2-[(7-Amino-1H-Indol-3-Yl)Methyl]Propanedioate |