|
CAS#: 73758-38-0 Product: 2-(1-Cyclohex-3-Enyl)-4,6-Dinitrophenol No suppilers available for the product. |
| Name | 2-(1-Cyclohex-3-Enyl)-4,6-Dinitrophenol |
|---|---|
| Synonyms | 2-(1-Cyclohex-3-Enyl)-4,6-Dinitro-Phenol; 2-(3-Cyclohexenyl)-4,6-Diaminophenol; Phenol, 2-(3-Cyclohexenyl)-4,6-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 |
| CAS Registry Number | 73758-38-0 |
| SMILES | C1=C(C(=C([N+]([O-])=O)C=C1[N+]([O-])=O)O)C2CC=CCC2 |
| InChI | 1S/C12H12N2O5/c15-12-10(8-4-2-1-3-5-8)6-9(13(16)17)7-11(12)14(18)19/h1-2,6-8,15H,3-5H2 |
| InChIKey | DGSNKEIBWIKGNZ-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.412°C at 760 mmHg (Cal.) |
| Flash point | 124.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Cyclohex-3-Enyl)-4,6-Dinitrophenol |